C27H26FN5O — CID 68632662
5-(4-fluorophenyl)-N-(6-methoxy-3,4-dihydropyridin-5-yl)-3-propan-2-yliminophenazin-2-amine (PubChem CID 68632662) has the molecular formula C27H26FN5O and a molecular weight of 455.54 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-(6-methoxy-3,4-dihydropyridin-5-yl)-3-propan-2-yliminophenazin-2-amine.
| Compound Name | 5-(4-fluorophenyl)-N-(6-methoxy-3,4-dihydropyridin-5-yl)-3-propan-2-yliminophenazin-2-amine |
|---|---|
| PubChem CID | 68632662 |
| Molecular Formula | C27H26FN5O |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 5-(4-fluorophenyl)-N-(6-methoxy-3,4-dihydropyridin-5-yl)-3-propan-2-yliminophenazin-2-amine |
| SMILES | COC1=C(Nc2cc3nc4ccccc4n(-c4ccc(F)cc4)c-3c/c2=N\C(C)C)CCC=N1 |
| InChI | InChI=1S/C27H26FN5O/c1-17(2)30-23-16-26-24(15-22(23)32-21-8-6-14-29-27(21)34-3)31-20-7-4-5-9-25(20)33(26)19-12-10-18(28)11-13-19/h4-5,7,9-17,32H,6,8H2,1-3H3/b30-23+ |
| InChIKey | SLNGYZNAYJSMOB-JJKYIXSRSA-N |
| XLogP | 5.67 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|