C31H30F3N5O2 — CID 123944991
3-(4-ethoxybutan-2-ylimino)-N-(6-methyl-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine (PubChem CID 123944991) has the molecular formula C31H30F3N5O2 and a molecular weight of 561.61 g/mol. Its IUPAC name is 3-(4-ethoxybutan-2-ylimino)-N-(6-methyl-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine.
| Compound Name | 3-(4-ethoxybutan-2-ylimino)-N-(6-methyl-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine |
|---|---|
| PubChem CID | 123944991 |
| Molecular Formula | C31H30F3N5O2 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | 3-(4-ethoxybutan-2-ylimino)-N-(6-methyl-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine |
| SMILES | CCOCCC(C)/N=c1\cc2n(-c3ccc(OC(F)(F)F)cc3)c3ccccc3nc-2cc1Nc1ccc(C)nc1 |
| InChI | InChI=1S/C31H30F3N5O2/c1-4-40-16-15-21(3)36-27-18-30-28(17-26(27)37-22-10-9-20(2)35-19-22)38-25-7-5-6-8-29(25)39(30)23-11-13-24(14-12-23)41-31(32,33)34/h5-14,17-19,21,37H,4,15-16H2,1-3H3/b36-27+ |
| InChIKey | XZOPWHYDFSPISK-KJFHWCLQSA-N |
| XLogP | 7.19 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|