C28H26N4O2 — CID 14020599
N,5-bis(4-ethoxyphenyl)-3-iminophenazin-2-amine (PubChem CID 14020599) has the molecular formula C28H26N4O2 and a molecular weight of 450.54 g/mol. Its IUPAC name is N,5-bis(4-ethoxyphenyl)-3-iminophenazin-2-amine.
| Compound Name | N,5-bis(4-ethoxyphenyl)-3-iminophenazin-2-amine |
|---|---|
| PubChem CID | 14020599 |
| Molecular Formula | C28H26N4O2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N,5-bis(4-ethoxyphenyl)-3-iminophenazin-2-amine |
| SMILES | [H]/N=c1\cc2n(-c3ccc(OCC)cc3)c3ccccc3nc-2cc1Nc1ccc(OCC)cc1 |
| InChI | InChI=1S/C28H26N4O2/c1-3-33-21-13-9-19(10-14-21)30-25-18-26-28(17-23(25)29)32(27-8-6-5-7-24(27)31-26)20-11-15-22(16-12-20)34-4-2/h5-18,29-30H,3-4H2,1-2H3/b29-23+ |
| InChIKey | VGFRHNZEYPXWJO-BYNJWEBRSA-N |
| XLogP | 6.15 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|