C35H39N5 — CID 14020653
3-[3-(cyclohexylamino)propylimino]-N,5-bis(4-methylphenyl)phenazin-2-amine (PubChem CID 14020653) has the molecular formula C35H39N5 and a molecular weight of 529.73 g/mol. Its IUPAC name is 3-[3-(cyclohexylamino)propylimino]-N,5-bis(4-methylphenyl)phenazin-2-amine.
| Compound Name | 3-[3-(cyclohexylamino)propylimino]-N,5-bis(4-methylphenyl)phenazin-2-amine |
|---|---|
| PubChem CID | 14020653 |
| Molecular Formula | C35H39N5 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | 3-[3-(cyclohexylamino)propylimino]-N,5-bis(4-methylphenyl)phenazin-2-amine |
| SMILES | Cc1ccc(Nc2cc3nc4ccccc4n(-c4ccc(C)cc4)c-3c/c2=N\CCCNC2CCCCC2)cc1 |
| InChI | InChI=1S/C35H39N5/c1-25-13-17-28(18-14-25)38-32-23-33-35(24-31(32)37-22-8-21-36-27-9-4-3-5-10-27)40(29-19-15-26(2)16-20-29)34-12-7-6-11-30(34)39-33/h6-7,11-20,23-24,27,36,38H,3-5,8-10,21-22H2,1-2H3/b37-31+ |
| InChIKey | UHDFTKSSVGWBIJ-USLOJTSYSA-N |
| XLogP | 7.70 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|