C27H25N7 — CID 71616573
2-[2-[(3-anilino-10-phenylphenazin-2-ylidene)amino]ethyl]guanidine (PubChem CID 71616573) has the molecular formula C27H25N7 and a molecular weight of 447.55 g/mol. Its IUPAC name is 2-[2-[(3-anilino-10-phenylphenazin-2-ylidene)amino]ethyl]guanidine.
| Compound Name | 2-[2-[(3-anilino-10-phenylphenazin-2-ylidene)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 71616573 |
| Molecular Formula | C27H25N7 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 2-[2-[(3-anilino-10-phenylphenazin-2-ylidene)amino]ethyl]guanidine |
| SMILES | NC(N)=NCC/N=c1\cc2n(-c3ccccc3)c3ccccc3nc-2cc1Nc1ccccc1 |
| InChI | InChI=1S/C27H25N7/c28-27(29)31-16-15-30-22-18-26-24(17-23(22)32-19-9-3-1-4-10-19)33-21-13-7-8-14-25(21)34(26)20-11-5-2-6-12-20/h1-14,17-18,32H,15-16H2,(H4,28,29,31)/b30-22+ |
| InChIKey | SFSXUVQQNVKVNE-JBASAIQMSA-N |
| XLogP | 4.05 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|