C29H29ClN6 — CID 164620749
5-(4-chlorophenyl)-3-[2-(diethylamino)ethylimino]-N-pyridin-3-ylphenazin-2-amine (PubChem CID 164620749) has the molecular formula C29H29ClN6 and a molecular weight of 497.05 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[2-(diethylamino)ethylimino]-N-pyridin-3-ylphenazin-2-amine.
| Compound Name | 5-(4-chlorophenyl)-3-[2-(diethylamino)ethylimino]-N-pyridin-3-ylphenazin-2-amine |
|---|---|
| PubChem CID | 164620749 |
| Molecular Formula | C29H29ClN6 |
| Molecular Weight | 497.05 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[2-(diethylamino)ethylimino]-N-pyridin-3-ylphenazin-2-amine |
| SMILES | CCN(CC)CC/N=c1\cc2n(-c3ccc(Cl)cc3)c3ccccc3nc-2cc1Nc1cccnc1 |
| InChI | InChI=1S/C29H29ClN6/c1-3-35(4-2)17-16-32-25-19-29-27(18-26(25)33-22-8-7-15-31-20-22)34-24-9-5-6-10-28(24)36(29)23-13-11-21(30)12-14-23/h5-15,18-20,33H,3-4,16-17H2,1-2H3/b32-25+ |
| InChIKey | JOAVAPFDKKAICC-WGPBWIAQSA-N |
| XLogP | 6.16 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.05 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|