C33H31Cl2N5 — CID 118721494
N,5-bis(4-chlorophenyl)-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethylimino]phenazin-2-amine (PubChem CID 118721494) has the molecular formula C33H31Cl2N5 and a molecular weight of 568.55 g/mol. Its IUPAC name is N,5-bis(4-chlorophenyl)-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethylimino]phenazin-2-amine.
| Compound Name | N,5-bis(4-chlorophenyl)-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethylimino]phenazin-2-amine |
|---|---|
| PubChem CID | 118721494 |
| Molecular Formula | C33H31Cl2N5 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | N,5-bis(4-chlorophenyl)-3-[2-(1,2,3,5,6,7-hexahydropyrrolizin-8-yl)ethylimino]phenazin-2-amine |
| SMILES | Clc1ccc(Nc2cc3nc4ccccc4n(-c4ccc(Cl)cc4)c-3c/c2=N\CCC23CCCN2CCC3)cc1 |
| InChI | InChI=1S/C33H31Cl2N5/c34-23-7-11-25(12-8-23)37-29-21-30-32(22-28(29)36-18-17-33-15-3-19-39(33)20-4-16-33)40(26-13-9-24(35)10-14-26)31-6-2-1-5-27(31)38-30/h1-2,5-14,21-22,37H,3-4,15-20H2/b36-28+ |
| InChIKey | OSSNRLBJGVLTNT-FDEZRRJOSA-N |
| XLogP | 8.10 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|