C27H23ClN6O — CID 66805753
5-(4-chlorophenyl)-3-(oxan-4-ylimino)-N-pyrimidin-5-ylphenazin-2-amine (PubChem CID 66805753) has the molecular formula C27H23ClN6O and a molecular weight of 482.98 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-(oxan-4-ylimino)-N-pyrimidin-5-ylphenazin-2-amine.
| Compound Name | 5-(4-chlorophenyl)-3-(oxan-4-ylimino)-N-pyrimidin-5-ylphenazin-2-amine |
|---|---|
| PubChem CID | 66805753 |
| Molecular Formula | C27H23ClN6O |
| Molecular Weight | 482.98 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 5-(4-chlorophenyl)-3-(oxan-4-ylimino)-N-pyrimidin-5-ylphenazin-2-amine |
| SMILES | Clc1ccc(-n2c3c/c(=N\C4CCOCC4)c(Nc4cncnc4)cc-3nc3ccccc32)cc1 |
| InChI | InChI=1S/C27H23ClN6O/c28-18-5-7-21(8-6-18)34-26-4-2-1-3-22(26)33-25-13-23(32-20-15-29-17-30-16-20)24(14-27(25)34)31-19-9-11-35-12-10-19/h1-8,13-17,19,32H,9-12H2/b31-24+ |
| InChIKey | BRPLXDVJNVXJEC-QFMPWRQOSA-N |
| XLogP | 5.40 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.98 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|