C31H29Cl2N5O — CID 14020622
N,5-bis(4-chlorophenyl)-3-(3-morpholin-4-ylpropylimino)phenazin-2-amine (PubChem CID 14020622) has the molecular formula C31H29Cl2N5O and a molecular weight of 558.51 g/mol. Its IUPAC name is N,5-bis(4-chlorophenyl)-3-(3-morpholin-4-ylpropylimino)phenazin-2-amine.
| Compound Name | N,5-bis(4-chlorophenyl)-3-(3-morpholin-4-ylpropylimino)phenazin-2-amine |
|---|---|
| PubChem CID | 14020622 |
| Molecular Formula | C31H29Cl2N5O |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | N,5-bis(4-chlorophenyl)-3-(3-morpholin-4-ylpropylimino)phenazin-2-amine |
| SMILES | Clc1ccc(Nc2cc3nc4ccccc4n(-c4ccc(Cl)cc4)c-3c/c2=N\CCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C31H29Cl2N5O/c32-22-6-10-24(11-7-22)35-28-20-29-31(21-27(28)34-14-3-15-37-16-18-39-19-17-37)38(25-12-8-23(33)9-13-25)30-5-2-1-4-26(30)36-29/h1-2,4-13,20-21,35H,3,14-19H2/b34-27+ |
| InChIKey | NHEIBPZLMDVOND-DNGXXSEMSA-N |
| XLogP | 6.80 |
| TPSA | 54.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|