C31H26Cl4N4S — CID 25254962
10-(3,4-dichlorophenyl)-3-(3,4-dichlorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylpropyl)phenazin-2-imine (PubChem CID 25254962) has the molecular formula C31H26Cl4N4S and a molecular weight of 628.46 g/mol. Its IUPAC name is 10-(3,4-dichlorophenyl)-3-(3,4-dichlorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylpropyl)phenazin-2-imine.
| Compound Name | 10-(3,4-dichlorophenyl)-3-(3,4-dichlorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylpropyl)phenazin-2-imine |
|---|---|
| PubChem CID | 25254962 |
| Molecular Formula | C31H26Cl4N4S |
| Molecular Weight | 628.46 g/mol |
| Exact Mass | 626.06 |
| IUPAC Name | 10-(3,4-dichlorophenyl)-3-(3,4-dichlorophenyl)sulfanyl-N-(3-pyrrolidin-1-ylpropyl)phenazin-2-imine |
| SMILES | Clc1ccc(Sc2cc3nc4ccccc4n(-c4ccc(Cl)c(Cl)c4)c-3c/c2=N/CCCN2CCCC2)cc1Cl |
| InChI | InChI=1S/C31H26Cl4N4S/c32-22-10-8-20(16-24(22)34)39-29-7-2-1-6-26(29)37-27-19-31(40-21-9-11-23(33)25(35)17-21)28(18-30(27)39)36-12-5-15-38-13-3-4-14-38/h1-2,6-11,16-19H,3-5,12-15H2/b36-28- |
| InChIKey | LOFUSRVYLSEUPM-DKJXEYTPSA-N |
| XLogP | 9.28 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.46 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|