C32H33ClN6 — CID 56592452
5-(4-chlorophenyl)-3-[1-(2-methylpropyl)piperidin-4-yl]imino-N-pyridin-3-ylphenazin-2-amine (PubChem CID 56592452) has the molecular formula C32H33ClN6 and a molecular weight of 537.11 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[1-(2-methylpropyl)piperidin-4-yl]imino-N-pyridin-3-ylphenazin-2-amine.
| Compound Name | 5-(4-chlorophenyl)-3-[1-(2-methylpropyl)piperidin-4-yl]imino-N-pyridin-3-ylphenazin-2-amine |
|---|---|
| PubChem CID | 56592452 |
| Molecular Formula | C32H33ClN6 |
| Molecular Weight | 537.11 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[1-(2-methylpropyl)piperidin-4-yl]imino-N-pyridin-3-ylphenazin-2-amine |
| SMILES | CC(C)CN1CCC(/N=c2\cc3n(-c4ccc(Cl)cc4)c4ccccc4nc-3cc2Nc2cccnc2)CC1 |
| InChI | InChI=1S/C32H33ClN6/c1-22(2)21-38-16-13-24(14-17-38)35-29-19-32-30(18-28(29)36-25-6-5-15-34-20-25)37-27-7-3-4-8-31(27)39(32)26-11-9-23(33)10-12-26/h3-12,15,18-20,22,24,36H,13-14,16-17,21H2,1-2H3/b35-29+ |
| InChIKey | UUBKUPJIHSDBLJ-OZMGXUMRSA-N |
| XLogP | 6.94 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.11 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|