C29H27ClN6 — CID 56591942
7-chloro-3-(1-methylpiperidin-4-yl)imino-5-phenyl-N-pyridin-3-ylphenazin-2-amine (PubChem CID 56591942) has the molecular formula C29H27ClN6 and a molecular weight of 495.03 g/mol. Its IUPAC name is 7-chloro-3-(1-methylpiperidin-4-yl)imino-5-phenyl-N-pyridin-3-ylphenazin-2-amine.
| Compound Name | 7-chloro-3-(1-methylpiperidin-4-yl)imino-5-phenyl-N-pyridin-3-ylphenazin-2-amine |
|---|---|
| PubChem CID | 56591942 |
| Molecular Formula | C29H27ClN6 |
| Molecular Weight | 495.03 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 7-chloro-3-(1-methylpiperidin-4-yl)imino-5-phenyl-N-pyridin-3-ylphenazin-2-amine |
| SMILES | CN1CCC(/N=c2\cc3n(-c4ccccc4)c4cc(Cl)ccc4nc-3cc2Nc2cccnc2)CC1 |
| InChI | InChI=1S/C29H27ClN6/c1-35-14-11-21(12-15-35)32-26-18-29-27(17-25(26)33-22-6-5-13-31-19-22)34-24-10-9-20(30)16-28(24)36(29)23-7-3-2-4-8-23/h2-10,13,16-19,21,33H,11-12,14-15H2,1H3/b32-26+ |
| InChIKey | FMLUOBPYPLVHIS-HMZBKAONSA-N |
| XLogP | 5.92 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.03 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|