C16H9Br2Cl2NO3S — CID 66811587
5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one (PubChem CID 66811587) has the molecular formula C16H9Br2Cl2NO3S and a molecular weight of 526.03 g/mol. Its IUPAC name is 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one.
| Compound Name | 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 66811587 |
| Molecular Formula | C16H9Br2Cl2NO3S |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 522.80 |
| IUPAC Name | 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2cc(Br)cc(Br)c2cc1S(=O)(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H9Br2Cl2NO3S/c17-9-3-12(18)11-6-15(16(22)21-14(11)4-9)25(23,24)7-8-1-2-10(19)5-13(8)20/h1-6H,7H2,(H,21,22) |
| InChIKey | HSVLNXYNFAVNBJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |