About 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one
5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one (PubChem CID 66811587) has the molecular formula C16H9Br2Cl2NO3S
and a molecular weight of 526.03 g/mol. Its IUPAC name is 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one |
| PubChem CID | 66811587 |
| Molecular Formula | C16H9Br2Cl2NO3S |
| Molecular Weight | 526.03 g/mol |
| Exact Mass | 522.80 |
| IUPAC Name | 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2cc(Br)cc(Br)c2cc1S(=O)(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H9Br2Cl2NO3S/c17-9-3-12(18)11-6-15(16(22)21-14(11)4-9)25(23,24)7-8-1-2-10(19)5-13(8)20/h1-6H,7H2,(H,21,22) |
| InChIKey | HSVLNXYNFAVNBJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.03 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one?
The IUPAC name of 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one (CID 66811587) is 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one.
What is the SMILES notation for 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one?
The canonical SMILES for 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one is O=c1[nH]c2cc(Br)cc(Br)c2cc1S(=O)(=O)Cc1ccc(Cl)cc1Cl.
What is the InChIKey of 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one?
The InChIKey is HSVLNXYNFAVNBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Br2Cl2NO3S/c17-9-3-12(18)11-6-15(16(22)21-14(11)4-9)25(23,24)7-8-1-2-10(19)5-13(8)20/h1-6H,7H2,(H,21,22).
What are the key properties of 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one?
5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one has a molecular weight of 526.03 g/mol, XLogP of 5.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dibromo-3-[(2,4-dichlorophenyl)methylsulfonyl]-1H-quinolin-2-one is sourced from PubChem (CID 66811587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).