C28H46N2O10 — CID 66902563
diethyl (1S,2S,4S,5R,6R)-2-[amino-[(2S)-7-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxoheptanoyl]amino]-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 66902563) has the molecular formula C28H46N2O10 and a molecular weight of 570.68 g/mol. Its IUPAC name is diethyl (1S,2S,4S,5R,6R)-2-[amino-[(2S)-7-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxoheptanoyl]amino]-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl (1S,2S,4S,5R,6R)-2-[amino-[(2S)-7-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxoheptanoyl]amino]-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 66902563 |
| Molecular Formula | C28H46N2O10 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | diethyl (1S,2S,4S,5R,6R)-2-[amino-[(2S)-7-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxoheptanoyl]amino]-4-hydroxybicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2[C@@H]1[C@@](C(=O)OCC)(N(N)C(=O)[C@H](CCCCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C[C@@H]2O |
| InChI | InChI=1S/C28H46N2O10/c1-9-37-24(35)20-19-17(31)15-28(21(19)20,25(36)38-10-2)30(29)22(33)16(23(34)40-27(6,7)8)13-11-12-14-18(32)39-26(3,4)5/h16-17,19-21,31H,9-15,29H2,1-8H3/t16-,17-,19-,20-,21-,28-/m0/s1 |
| InChIKey | OXTFKMKCUATVNQ-XQGJCNAESA-N |
| XLogP | 2.04 |
| TPSA | 171.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|