C23H37N3O9 — CID 69259255
diethyl 4-hydroxy-2-[[[(2-methylpropan-2-yl)oxycarbonylamino]-propanoylamino]-propanoylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 69259255) has the molecular formula C23H37N3O9 and a molecular weight of 499.56 g/mol. Its IUPAC name is diethyl 4-hydroxy-2-[[[(2-methylpropan-2-yl)oxycarbonylamino]-propanoylamino]-propanoylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl 4-hydroxy-2-[[[(2-methylpropan-2-yl)oxycarbonylamino]-propanoylamino]-propanoylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 69259255 |
| Molecular Formula | C23H37N3O9 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | diethyl 4-hydroxy-2-[[[(2-methylpropan-2-yl)oxycarbonylamino]-propanoylamino]-propanoylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)C1C2C(O)CC(C(=O)OCC)(N(C(=O)CC)N(NC(=O)OC(C)(C)C)C(=O)CC)C12 |
| InChI | InChI=1S/C23H37N3O9/c1-8-14(28)25(26(15(29)9-2)24-21(32)35-22(5,6)7)23(20(31)34-11-4)12-13(27)16-17(18(16)23)19(30)33-10-3/h13,16-18,27H,8-12H2,1-7H3,(H,24,32) |
| InChIKey | DDZXPGLHOGPVMS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|