C22H35N3O9 — CID 69258170
diethyl 4-hydroxy-2-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-propanoylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 69258170) has the molecular formula C22H35N3O9 and a molecular weight of 485.53 g/mol. Its IUPAC name is diethyl 4-hydroxy-2-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-propanoylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl 4-hydroxy-2-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-propanoylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 69258170 |
| Molecular Formula | C22H35N3O9 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | diethyl 4-hydroxy-2-[[[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]-propanoylamino]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)C1C2C(O)CC(C(=O)OCC)(N(NC(=O)CNC(=O)OC(C)(C)C)C(=O)CC)C12 |
| InChI | InChI=1S/C22H35N3O9/c1-7-14(28)25(24-13(27)11-23-20(31)34-21(4,5)6)22(19(30)33-9-3)10-12(26)15-16(17(15)22)18(29)32-8-2/h12,15-17,26H,7-11H2,1-6H3,(H,23,31)(H,24,27) |
| InChIKey | VXELIWKZJRXUIZ-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|