C32H34ClN5O3 — CID 66914942
2-[3-(4-chlorophenyl)-1-(2-methoxyethyl)pyrrol-2-yl]-N-[4-[4-(3,4-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide (PubChem CID 66914942) has the molecular formula C32H34ClN5O3 and a molecular weight of 572.11 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-1-(2-methoxyethyl)pyrrol-2-yl]-N-[4-[4-(3,4-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-1-(2-methoxyethyl)pyrrol-2-yl]-N-[4-[4-(3,4-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 66914942 |
| Molecular Formula | C32H34ClN5O3 |
| Molecular Weight | 572.11 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-1-(2-methoxyethyl)pyrrol-2-yl]-N-[4-[4-(3,4-dimethyl-2-pyridinyl)piperazin-1-yl]phenyl]-2-oxoacetamide |
| SMILES | COCCn1ccc(-c2ccc(Cl)cc2)c1C(=O)C(=O)Nc1ccc(N2CCN(c3nccc(C)c3C)CC2)cc1 |
| InChI | InChI=1S/C32H34ClN5O3/c1-22-12-14-34-31(23(22)2)38-18-16-36(17-19-38)27-10-8-26(9-11-27)35-32(40)30(39)29-28(13-15-37(29)20-21-41-3)24-4-6-25(33)7-5-24/h4-15H,16-21H2,1-3H3,(H,35,40) |
| InChIKey | UMFHTPFKOSFKHD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.11 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|