C18H13Cl2FN2O3S — CID 66917923
N-(3,5-dichlorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide (PubChem CID 66917923) has the molecular formula C18H13Cl2FN2O3S and a molecular weight of 427.28 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide.
| Compound Name | N-(3,5-dichlorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 66917923 |
| Molecular Formula | C18H13Cl2FN2O3S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | N-(3,5-dichlorophenyl)sulfonyl-3-(5-fluoro-3-methyl-1H-indol-7-yl)prop-2-enamide |
| SMILES | Cc1c[nH]c2c(C=CC(=O)NS(=O)(=O)c3cc(Cl)cc(Cl)c3)cc(F)cc12 |
| InChI | InChI=1S/C18H13Cl2FN2O3S/c1-10-9-22-18-11(4-14(21)8-16(10)18)2-3-17(24)23-27(25,26)15-6-12(19)5-13(20)7-15/h2-9,22H,1H3,(H,23,24) |
| InChIKey | CVVJOAWKIRZKDO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|