C22H26O7 — CID 66919987
(2S,3R,4S,5S,6R)-6-(hydroxymethyl)-2-[(3R)-3-(4-methoxyphenyl)-2,3-dihydro-1H-inden-5-yl]oxane-2,3,4,5-tetrol (PubChem CID 66919987) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-(hydroxymethyl)-2-[(3R)-3-(4-methoxyphenyl)-2,3-dihydro-1H-inden-5-yl]oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3R,4S,5S,6R)-6-(hydroxymethyl)-2-[(3R)-3-(4-methoxyphenyl)-2,3-dihydro-1H-inden-5-yl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 66919987 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-(hydroxymethyl)-2-[(3R)-3-(4-methoxyphenyl)-2,3-dihydro-1H-inden-5-yl]oxane-2,3,4,5-tetrol |
| SMILES | COc1ccc([C@H]2CCc3ccc([C@]4(O)O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc32)cc1 |
| InChI | InChI=1S/C22H26O7/c1-28-15-7-3-12(4-8-15)16-9-5-13-2-6-14(10-17(13)16)22(27)21(26)20(25)19(24)18(11-23)29-22/h2-4,6-8,10,16,18-21,23-27H,5,9,11H2,1H3/t16-,18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | LDEJPSVMAAQDQE-MRARYGSRSA-N |
| XLogP | 0.39 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |