About diphenylphosphane;triethoxy(ethyl)silane
diphenylphosphane;triethoxy(ethyl)silane (PubChem CID 67019736) has the molecular formula C20H31O3PSi
and a molecular weight of 378.52 g/mol. Its IUPAC name is diphenylphosphane;triethoxy(ethyl)silane.
Molecular Properties
| Compound Name | diphenylphosphane;triethoxy(ethyl)silane |
| PubChem CID | 67019736 |
| Molecular Formula | C20H31O3PSi |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | diphenylphosphane;triethoxy(ethyl)silane |
| SMILES | CCO[Si](CC)(OCC)OCC.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.C8H20O3Si/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-9-12(8-4,10-6-2)11-7-3/h1-10,13H;5-8H2,1-4H3 |
| InChIKey | QWQPCYTVXHYMHG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;triethoxy(ethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;triethoxy(ethyl)silane?
The IUPAC name of diphenylphosphane;triethoxy(ethyl)silane (CID 67019736) is diphenylphosphane;triethoxy(ethyl)silane.
What is the SMILES notation for diphenylphosphane;triethoxy(ethyl)silane?
The canonical SMILES for diphenylphosphane;triethoxy(ethyl)silane is CCO[Si](CC)(OCC)OCC.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;triethoxy(ethyl)silane?
The InChIKey is QWQPCYTVXHYMHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.C8H20O3Si/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-9-12(8-4,10-6-2)11-7-3/h1-10,13H;5-8H2,1-4H3.
What are the key properties of diphenylphosphane;triethoxy(ethyl)silane?
diphenylphosphane;triethoxy(ethyl)silane has a molecular weight of 378.52 g/mol, XLogP of 4.37, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;triethoxy(ethyl)silane is sourced from PubChem (CID 67019736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).