C18H18ClN5O7 — CID 67061125
3-amino-1-[3-(7-nitro-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 67061125) has the molecular formula C18H18ClN5O7 and a molecular weight of 451.82 g/mol. Its IUPAC name is 3-amino-1-[3-(7-nitro-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-amino-1-[3-(7-nitro-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 67061125 |
| Molecular Formula | C18H18ClN5O7 |
| Molecular Weight | 451.82 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | 3-amino-1-[3-(7-nitro-3-oxo-1H-isoindol-2-yl)-2,6-dioxopiperidin-1-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.NC1CCC(=O)N(N2C(=O)CCC(N3Cc4c(cccc4[N+](=O)[O-])C3=O)C2=O)C1=O |
| InChI | InChI=1S/C18H17N5O7.ClH/c19-11-4-6-14(24)21(17(11)27)22-15(25)7-5-13(18(22)28)20-8-10-9(16(20)26)2-1-3-12(10)23(29)30;/h1-3,11,13H,4-8,19H2;1H |
| InChIKey | XEMHBLAPRJJHNW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 164.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.82 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|