C22H23N3O4 — CID 67066297
1-[3-tert-butyl-5-[2-(4-nitrophenyl)ethenyl]phenyl]-1,3-diazinane-2,4-dione (PubChem CID 67066297) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-[3-tert-butyl-5-[2-(4-nitrophenyl)ethenyl]phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[3-tert-butyl-5-[2-(4-nitrophenyl)ethenyl]phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 67066297 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-[3-tert-butyl-5-[2-(4-nitrophenyl)ethenyl]phenyl]-1,3-diazinane-2,4-dione |
| SMILES | CC(C)(C)c1cc(C=Cc2ccc([N+](=O)[O-])cc2)cc(N2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-22(2,3)17-12-16(5-4-15-6-8-18(9-7-15)25(28)29)13-19(14-17)24-11-10-20(26)23-21(24)27/h4-9,12-14H,10-11H2,1-3H3,(H,23,26,27) |
| InChIKey | UXVJNJXNFTVINO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|