2,5-dioxoimidazolidine-1-sulfonic acid

C3H4N2O5S — CID 67119143

IUPAC2,5-dioxoimidazolidine-1-sulfonic acid
SMILESO=C1CNC(=O)N1S(=O)(=O)O
InChIInChI=1S/C3H4N2O5S/c6-2-1-4-3(7)5(2)11(8,9)10/h1H2,(H,4,7)(H,8,9,10)
InChIKeyONAKLUOXWARQIE-UHFFFAOYSA-N
MW180.14 g/mol
LogP-1.66
Rot. Bonds1

About 2,5-dioxoimidazolidine-1-sulfonic acid

2,5-dioxoimidazolidine-1-sulfonic acid (PubChem CID 67119143) has the molecular formula C3H4N2O5S and a molecular weight of 180.14 g/mol. Its IUPAC name is 2,5-dioxoimidazolidine-1-sulfonic acid.

Molecular Properties

Compound Name2,5-dioxoimidazolidine-1-sulfonic acid
PubChem CID67119143
Molecular FormulaC3H4N2O5S
Molecular Weight180.14 g/mol
Exact Mass179.98
IUPAC Name2,5-dioxoimidazolidine-1-sulfonic acid
SMILESO=C1CNC(=O)N1S(=O)(=O)O
InChIInChI=1S/C3H4N2O5S/c6-2-1-4-3(7)5(2)11(8,9)10/h1H2,(H,4,7)(H,8,9,10)
InChIKeyONAKLUOXWARQIE-UHFFFAOYSA-N
XLogP-1.66
TPSA103.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.14
LogP ≤ 5-1.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,5-dioxoimidazolidine-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dioxoimidazolidine-1-sulfonic acid?
The IUPAC name of 2,5-dioxoimidazolidine-1-sulfonic acid (CID 67119143) is 2,5-dioxoimidazolidine-1-sulfonic acid.
What is the SMILES notation for 2,5-dioxoimidazolidine-1-sulfonic acid?
The canonical SMILES for 2,5-dioxoimidazolidine-1-sulfonic acid is O=C1CNC(=O)N1S(=O)(=O)O.
What is the InChIKey of 2,5-dioxoimidazolidine-1-sulfonic acid?
The InChIKey is ONAKLUOXWARQIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O5S/c6-2-1-4-3(7)5(2)11(8,9)10/h1H2,(H,4,7)(H,8,9,10).
What are the key properties of 2,5-dioxoimidazolidine-1-sulfonic acid?
2,5-dioxoimidazolidine-1-sulfonic acid has a molecular weight of 180.14 g/mol, XLogP of -1.66, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dioxoimidazolidine-1-sulfonic acid is sourced from PubChem (CID 67119143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).