C15H24BNO10 — CID 67121048
(2S)-2-amino-3-(4-boronophenyl)propanoic acid;(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 67121048) has the molecular formula C15H24BNO10 and a molecular weight of 389.17 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-boronophenyl)propanoic acid;(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | (2S)-2-amino-3-(4-boronophenyl)propanoic acid;(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 67121048 |
| Molecular Formula | C15H24BNO10 |
| Molecular Weight | 389.17 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (2S)-2-amino-3-(4-boronophenyl)propanoic acid;(3S,4R,5R)-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | N[C@@H](Cc1ccc(B(O)O)cc1)C(=O)O.O=C(CO)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H12BNO4.C6H12O6/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15;7-1-3(9)5(11)6(12)4(10)2-8/h1-4,8,14-15H,5,11H2,(H,12,13);3,5-9,11-12H,1-2H2/t8-;3-,5-,6-/m01/s1 |
| InChIKey | PSWYBAVQBPKQRW-ODCKYCSKSA-N |
| XLogP | -5.06 |
| TPSA | 222.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.17 |
| LogP ≤ 5 | -5.06 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|