C7H4NNaO2S2 — CID 67122946
sodium 1,3-benzothiazole-6-sulfinate (PubChem CID 67122946) has the molecular formula C7H4NNaO2S2 and a molecular weight of 221.24 g/mol. Its IUPAC name is sodium 1,3-benzothiazole-6-sulfinate.
| Compound Name | sodium 1,3-benzothiazole-6-sulfinate |
|---|---|
| PubChem CID | 67122946 |
| Molecular Formula | C7H4NNaO2S2 |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 220.96 |
| IUPAC Name | sodium 1,3-benzothiazole-6-sulfinate |
| SMILES | O=S([O-])c1ccc2ncsc2c1.[Na+] |
| InChI | InChI=1S/C7H5NO2S2.Na/c9-12(10)5-1-2-6-7(3-5)11-4-8-6;/h1-4H,(H,9,10);/q;+1/p-1 |
| InChIKey | WNQDULXVXHDUFY-UHFFFAOYSA-M |
| XLogP | -1.46 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|