C37H43NO3Si — CID 67151360
benzyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-[(9-phenylfluoren-9-yl)amino]butanoate (PubChem CID 67151360) has the molecular formula C37H43NO3Si and a molecular weight of 577.84 g/mol. Its IUPAC name is benzyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-[(9-phenylfluoren-9-yl)amino]butanoate.
| Compound Name | benzyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-[(9-phenylfluoren-9-yl)amino]butanoate |
|---|---|
| PubChem CID | 67151360 |
| Molecular Formula | C37H43NO3Si |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | benzyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-2-[(9-phenylfluoren-9-yl)amino]butanoate |
| SMILES | CC(C)[C@](NC1(c2ccccc2)c2ccccc2-c2ccccc21)(O[Si](C)(C)C(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H43NO3Si/c1-27(2)37(41-42(6,7)35(3,4)5,34(39)40-26-28-18-10-8-11-19-28)38-36(29-20-12-9-13-21-29)32-24-16-14-22-30(32)31-23-15-17-25-33(31)36/h8-25,27,38H,26H2,1-7H3/t37-/m0/s1 |
| InChIKey | PNZINWNUKWKHBW-QNGWXLTQSA-N |
| XLogP | 8.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|