C37H43NO3Si — CID 90465698
(2S,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-phenyl-2-[(9-phenylfluoren-9-yl)amino]pentanoic acid (PubChem CID 90465698) has the molecular formula C37H43NO3Si and a molecular weight of 577.84 g/mol. Its IUPAC name is (2S,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-phenyl-2-[(9-phenylfluoren-9-yl)amino]pentanoic acid.
| Compound Name | (2S,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-phenyl-2-[(9-phenylfluoren-9-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 90465698 |
| Molecular Formula | C37H43NO3Si |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | (2S,3S)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-5-phenyl-2-[(9-phenylfluoren-9-yl)amino]pentanoic acid |
| SMILES | C[C@H](C(Cc1ccccc1)O[Si](C)(C)C(C)(C)C)[C@H](NC1(c2ccccc2)c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C37H43NO3Si/c1-26(33(25-27-17-9-7-10-18-27)41-42(5,6)36(2,3)4)34(35(39)40)38-37(28-19-11-8-12-20-28)31-23-15-13-21-29(31)30-22-14-16-24-32(30)37/h7-24,26,33-34,38H,25H2,1-6H3,(H,39,40)/t26-,33?,34+/m1/s1 |
| InChIKey | GQZDJNJBAZLKMF-UVYOXQOCSA-N |
| XLogP | 8.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|