C14H16N4OS — CID 67214426
azane;1-(3,7-diaminophenothiazin-10-yl)ethanone (PubChem CID 67214426) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is azane;1-(3,7-diaminophenothiazin-10-yl)ethanone.
| Compound Name | azane;1-(3,7-diaminophenothiazin-10-yl)ethanone |
|---|---|
| PubChem CID | 67214426 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | azane;1-(3,7-diaminophenothiazin-10-yl)ethanone |
| SMILES | CC(=O)N1c2ccc(N)cc2Sc2cc(N)ccc21.N |
| InChI | InChI=1S/C14H13N3OS.H3N/c1-8(18)17-11-4-2-9(15)6-13(11)19-14-7-10(16)3-5-12(14)17;/h2-7H,15-16H2,1H3;1H3 |
| InChIKey | AIZJDCPZNCZIBB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|