C18H20N8O4 — CID 67317893
(6'aR,7'R,9'S)-7',9'-dimethyl-3'-(1-methyltetrazol-5-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione (PubChem CID 67317893) has the molecular formula C18H20N8O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is (6'aR,7'R,9'S)-7',9'-dimethyl-3'-(1-methyltetrazol-5-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione.
| Compound Name | (6'aR,7'R,9'S)-7',9'-dimethyl-3'-(1-methyltetrazol-5-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
|---|---|
| PubChem CID | 67317893 |
| Molecular Formula | C18H20N8O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (6'aR,7'R,9'S)-7',9'-dimethyl-3'-(1-methyltetrazol-5-yl)spiro[1,3-diazinane-5,6'-6a,7,9,10-tetrahydro-5H-[1,4]oxazino[4,3-a][1,8]naphthyridine]-2,4,6-trione |
| SMILES | C[C@H]1CN2c3ncc(-c4nnnn4C)cc3CC3(C(=O)NC(=O)NC3=O)[C@@H]2[C@@H](C)O1 |
| InChI | InChI=1S/C18H20N8O4/c1-8-7-26-12(9(2)30-8)18(15(27)20-17(29)21-16(18)28)5-10-4-11(6-19-13(10)26)14-22-23-24-25(14)3/h4,6,8-9,12H,5,7H2,1-3H3,(H2,20,21,27,28,29)/t8-,9+,12-/m0/s1 |
| InChIKey | CKSBZJLJXWMZTC-SBMIAAHKSA-N |
| XLogP | -0.84 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|