C21H23N5O3S — CID 67346455
(1R)-1-[7-(benzenesulfonyl)-3-piperidin-3-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol (PubChem CID 67346455) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is (1R)-1-[7-(benzenesulfonyl)-3-piperidin-3-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol.
| Compound Name | (1R)-1-[7-(benzenesulfonyl)-3-piperidin-3-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 67346455 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | (1R)-1-[7-(benzenesulfonyl)-3-piperidin-3-yl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl]ethanol |
| SMILES | C[C@@H](O)c1nc2c(S(=O)(=O)c3ccccc3)nc3[nH]ccc3c2n1C1CCCNC1 |
| InChI | InChI=1S/C21H23N5O3S/c1-13(27)20-24-17-18(26(20)14-6-5-10-22-12-14)16-9-11-23-19(16)25-21(17)30(28,29)15-7-3-2-4-8-15/h2-4,7-9,11,13-14,22,27H,5-6,10,12H2,1H3,(H,23,25)/t13-,14?/m1/s1 |
| InChIKey | LILCXLXZDUUXMD-KWCCSABGSA-N |
| XLogP | 2.72 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |