C18H25F3N4O2 — CID 67354875
4-[3-amino-4-(2,3,4-trifluorophenyl)butanoyl]-3-(propylaminomethyl)piperazin-2-one (PubChem CID 67354875) has the molecular formula C18H25F3N4O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is 4-[3-amino-4-(2,3,4-trifluorophenyl)butanoyl]-3-(propylaminomethyl)piperazin-2-one.
| Compound Name | 4-[3-amino-4-(2,3,4-trifluorophenyl)butanoyl]-3-(propylaminomethyl)piperazin-2-one |
|---|---|
| PubChem CID | 67354875 |
| Molecular Formula | C18H25F3N4O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[3-amino-4-(2,3,4-trifluorophenyl)butanoyl]-3-(propylaminomethyl)piperazin-2-one |
| SMILES | CCCNCC1C(=O)NCCN1C(=O)CC(N)Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H25F3N4O2/c1-2-5-23-10-14-18(27)24-6-7-25(14)15(26)9-12(22)8-11-3-4-13(19)17(21)16(11)20/h3-4,12,14,23H,2,5-10,22H2,1H3,(H,24,27) |
| InChIKey | NOMOICKOTOTEQA-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|