C17H20N4O2S — CID 6736641
2-(2-sulfanylideneimidazolidin-1-yl)ethyl 1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 6736641) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-(2-sulfanylideneimidazolidin-1-yl)ethyl 1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | 2-(2-sulfanylideneimidazolidin-1-yl)ethyl 1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 6736641 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-(2-sulfanylideneimidazolidin-1-yl)ethyl 1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(OCCN1CCNC1=S)N1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C17H20N4O2S/c22-17(23-10-9-20-8-6-18-16(20)24)21-7-5-13-12-3-1-2-4-14(12)19-15(13)11-21/h1-4,19H,5-11H2,(H,18,24) |
| InChIKey | SPHQUDVHPICTIW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|