C29H26N4O3S — CID 67409088
2,5-dimethyl-N-(4-methylsulfonylphenyl)-1-[4-(6-pyrrol-1-yl-3-pyridinyl)phenyl]pyrrole-3-carboxamide (PubChem CID 67409088) has the molecular formula C29H26N4O3S and a molecular weight of 510.62 g/mol. Its IUPAC name is 2,5-dimethyl-N-(4-methylsulfonylphenyl)-1-[4-(6-pyrrol-1-yl-3-pyridinyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-(4-methylsulfonylphenyl)-1-[4-(6-pyrrol-1-yl-3-pyridinyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67409088 |
| Molecular Formula | C29H26N4O3S |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | 2,5-dimethyl-N-(4-methylsulfonylphenyl)-1-[4-(6-pyrrol-1-yl-3-pyridinyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(S(C)(=O)=O)cc2)c(C)n1-c1ccc(-c2ccc(-n3cccc3)nc2)cc1 |
| InChI | InChI=1S/C29H26N4O3S/c1-20-18-27(29(34)31-24-9-13-26(14-10-24)37(3,35)36)21(2)33(20)25-11-6-22(7-12-25)23-8-15-28(30-19-23)32-16-4-5-17-32/h4-19H,1-3H3,(H,31,34) |
| InChIKey | FNWRARLKOVLYEO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|