C49H49NO5 — CID 67459523
4-(4-cyclopropylphenyl)-3-[(1R,2S,3R,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]oxypyridine (PubChem CID 67459523) has the molecular formula C49H49NO5 and a molecular weight of 731.93 g/mol. Its IUPAC name is 4-(4-cyclopropylphenyl)-3-[(1R,2S,3R,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]oxypyridine.
| Compound Name | 4-(4-cyclopropylphenyl)-3-[(1R,2S,3R,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]oxypyridine |
|---|---|
| PubChem CID | 67459523 |
| Molecular Formula | C49H49NO5 |
| Molecular Weight | 731.93 g/mol |
| Exact Mass | 731.36 |
| IUPAC Name | 4-(4-cyclopropylphenyl)-3-[(1R,2S,3R,4R,5R)-2,3,4-tris(phenylmethoxy)-5-(phenylmethoxymethyl)cyclohexyl]oxypyridine |
| SMILES | c1ccc(COC[C@H]2CC(Oc3cnccc3-c3ccc(C4CC4)cc3)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C49H49NO5/c1-5-13-36(14-6-1)31-51-35-43-29-45(55-46-30-50-28-27-44(46)42-25-23-41(24-26-42)40-21-22-40)48(53-33-38-17-9-3-10-18-38)49(54-34-39-19-11-4-12-20-39)47(43)52-32-37-15-7-2-8-16-37/h1-20,23-28,30,40,43,45,47-49H,21-22,29,31-35H2/t43-,45?,47-,48+,49-/m1/s1 |
| InChIKey | SQSGFMSSBJKGOY-FPFIWGFRSA-N |
| XLogP | 10.37 |
| TPSA | 59.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.93 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |