C24H26BrN3O2S — CID 67495450
(1S,2R,3R,4R)-N-(4-bromophenyl)-3-[[[2-(2,5-dimethyl-1,3-thiazol-4-yl)acetyl]amino]methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide (PubChem CID 67495450) has the molecular formula C24H26BrN3O2S and a molecular weight of 500.46 g/mol. Its IUPAC name is (1S,2R,3R,4R)-N-(4-bromophenyl)-3-[[[2-(2,5-dimethyl-1,3-thiazol-4-yl)acetyl]amino]methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide.
| Compound Name | (1S,2R,3R,4R)-N-(4-bromophenyl)-3-[[[2-(2,5-dimethyl-1,3-thiazol-4-yl)acetyl]amino]methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
|---|---|
| PubChem CID | 67495450 |
| Molecular Formula | C24H26BrN3O2S |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | (1S,2R,3R,4R)-N-(4-bromophenyl)-3-[[[2-(2,5-dimethyl-1,3-thiazol-4-yl)acetyl]amino]methyl]spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-carboxamide |
| SMILES | Cc1nc(CC(=O)NC[C@H]2[C@H](C(=O)Nc3ccc(Br)cc3)[C@@H]3C=C[C@H]2C32CC2)c(C)s1 |
| InChI | InChI=1S/C24H26BrN3O2S/c1-13-20(27-14(2)31-13)11-21(29)26-12-17-18-7-8-19(24(18)9-10-24)22(17)23(30)28-16-5-3-15(25)4-6-16/h3-8,17-19,22H,9-12H2,1-2H3,(H,26,29)(H,28,30)/t17-,18-,19+,22+/m1/s1 |
| InChIKey | ZEBDHWJXZZUPDE-IWQHBPENSA-N |
| XLogP | 4.65 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|