C18H18Cl2N4O3 — CID 67503515
methyl 2-[(3,5-dichloro-4-pyridinyl)amino]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxylate (PubChem CID 67503515) has the molecular formula C18H18Cl2N4O3 and a molecular weight of 409.27 g/mol. Its IUPAC name is methyl 2-[(3,5-dichloro-4-pyridinyl)amino]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[(3,5-dichloro-4-pyridinyl)amino]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 67503515 |
| Molecular Formula | C18H18Cl2N4O3 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | methyl 2-[(3,5-dichloro-4-pyridinyl)amino]-7,7-dimethyl-1,2,3,8-tetrahydrofuro[3,2-e]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1cc2c(c3c1OC(C)(C)C3)NC(Nc1c(Cl)cncc1Cl)N2 |
| InChI | InChI=1S/C18H18Cl2N4O3/c1-18(2)5-9-13-12(4-8(15(9)27-18)16(25)26-3)22-17(23-13)24-14-10(19)6-21-7-11(14)20/h4,6-7,17,22-23H,5H2,1-3H3,(H,21,24) |
| InChIKey | YEZMPVVHGFVBEM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|