C12H14ClNO2 — CID 67517329
N-[2-chloro-3-(4-hydroxyphenyl)propyl]prop-2-enamide (PubChem CID 67517329) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is N-[2-chloro-3-(4-hydroxyphenyl)propyl]prop-2-enamide.
| Compound Name | N-[2-chloro-3-(4-hydroxyphenyl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 67517329 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N-[2-chloro-3-(4-hydroxyphenyl)propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(Cl)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C12H14ClNO2/c1-2-12(16)14-8-10(13)7-9-3-5-11(15)6-4-9/h2-6,10,15H,1,7-8H2,(H,14,16) |
| InChIKey | MPXPBONVFXAWSP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|