C16H19N3O2S — CID 67570619
3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-2-methylaniline;hydrate (PubChem CID 67570619) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-2-methylaniline;hydrate.
| Compound Name | 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-2-methylaniline;hydrate |
|---|---|
| PubChem CID | 67570619 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]-2-methylaniline;hydrate |
| SMILES | CCOc1ccc2nc(Sc3cccc(N)c3C)[nH]c2c1.O |
| InChI | InChI=1S/C16H17N3OS.H2O/c1-3-20-11-7-8-13-14(9-11)19-16(18-13)21-15-6-4-5-12(17)10(15)2;/h4-9H,3,17H2,1-2H3,(H,18,19);1H2 |
| InChIKey | BONNZRAUNDFMQO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|