C13H13N5OS — CID 102988673
3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]pyrazin-2-amine (PubChem CID 102988673) has the molecular formula C13H13N5OS and a molecular weight of 287.35 g/mol. Its IUPAC name is 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]pyrazin-2-amine.
| Compound Name | 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 102988673 |
| Molecular Formula | C13H13N5OS |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]pyrazin-2-amine |
| SMILES | CCOc1ccc2nc(Sc3nccnc3N)[nH]c2c1 |
| InChI | InChI=1S/C13H13N5OS/c1-2-19-8-3-4-9-10(7-8)18-13(17-9)20-12-11(14)15-5-6-16-12/h3-7H,2H2,1H3,(H2,14,15)(H,17,18) |
| InChIKey | LTIXSCNJBDQBSF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |