C14H15N5OS — CID 80515683
[3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]pyridazin-4-yl]methanamine (PubChem CID 80515683) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is [3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]pyridazin-4-yl]methanamine.
| Compound Name | [3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]pyridazin-4-yl]methanamine |
|---|---|
| PubChem CID | 80515683 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [3-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]pyridazin-4-yl]methanamine |
| SMILES | CCOc1ccc2nc(Sc3nnccc3CN)[nH]c2c1 |
| InChI | InChI=1S/C14H15N5OS/c1-2-20-10-3-4-11-12(7-10)18-14(17-11)21-13-9(8-15)5-6-16-19-13/h3-7H,2,8,15H2,1H3,(H,17,18) |
| InChIKey | YENXUBXKERPJPA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |