C23H26F3N5O4 — CID 67583221
2-[amino(3-methylbutanoyl)amino]-3-[2-[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]phenyl]propanoic acid (PubChem CID 67583221) has the molecular formula C23H26F3N5O4 and a molecular weight of 493.49 g/mol. Its IUPAC name is 2-[amino(3-methylbutanoyl)amino]-3-[2-[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]phenyl]propanoic acid.
| Compound Name | 2-[amino(3-methylbutanoyl)amino]-3-[2-[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67583221 |
| Molecular Formula | C23H26F3N5O4 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 2-[amino(3-methylbutanoyl)amino]-3-[2-[3-(hydrazinylmethylideneamino)-5-(trifluoromethyl)benzoyl]phenyl]propanoic acid |
| SMILES | CC(C)CC(=O)N(N)C(Cc1ccccc1C(=O)c1cc(/N=C/NN)cc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C23H26F3N5O4/c1-13(2)7-20(32)31(28)19(22(34)35)10-14-5-3-4-6-18(14)21(33)15-8-16(23(24,25)26)11-17(9-15)29-12-30-27/h3-6,8-9,11-13,19H,7,10,27-28H2,1-2H3,(H,29,30)(H,34,35) |
| InChIKey | DWHWVVYCWGAQAJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|