C19H18F2O6S2 — CID 67588791
3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylsulfonylphenyl)-2H-furan-2-ol (PubChem CID 67588791) has the molecular formula C19H18F2O6S2 and a molecular weight of 444.48 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylsulfonylphenyl)-2H-furan-2-ol.
| Compound Name | 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylsulfonylphenyl)-2H-furan-2-ol |
|---|---|
| PubChem CID | 67588791 |
| Molecular Formula | C19H18F2O6S2 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 3-(3,5-difluorophenyl)-5,5-dimethyl-4-(4-methylsulfonylsulfonylphenyl)-2H-furan-2-ol |
| SMILES | CC1(C)OC(O)C(c2cc(F)cc(F)c2)=C1c1ccc(S(=O)(=O)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H18F2O6S2/c1-19(2)17(11-4-6-15(7-5-11)29(25,26)28(3,23)24)16(18(22)27-19)12-8-13(20)10-14(21)9-12/h4-10,18,22H,1-3H3 |
| InChIKey | ZVZJACVZGAGYNK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|