C34H38N4O6 — CID 67612185
3-O-methyl 5-O-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67612185) has the molecular formula C34H38N4O6 and a molecular weight of 598.70 g/mol. Its IUPAC name is 3-O-methyl 5-O-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67612185 |
| Molecular Formula | C34H38N4O6 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 3-O-methyl 5-O-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCNc2c3c(nc4ccccc24)CCCC3)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H38N4O6/c1-21-29(33(39)43-3)31(23-12-11-13-24(20-23)38(41)42)30(22(2)36-21)34(40)44-19-10-4-9-18-35-32-25-14-5-7-16-27(25)37-28-17-8-6-15-26(28)32/h5,7,11-14,16,20,31,36H,4,6,8-10,15,17-19H2,1-3H3,(H,35,37) |
| InChIKey | YBMTWQJJWWVTKU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|