C23H24N4O4S — CID 67616662
3-[3-[4-(diaminomethylideneamino)phenyl]sulfonyl-2-(methylamino)phenyl]-3-phenylpropanoic acid (PubChem CID 67616662) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is 3-[3-[4-(diaminomethylideneamino)phenyl]sulfonyl-2-(methylamino)phenyl]-3-phenylpropanoic acid.
| Compound Name | 3-[3-[4-(diaminomethylideneamino)phenyl]sulfonyl-2-(methylamino)phenyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67616662 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 3-[3-[4-(diaminomethylideneamino)phenyl]sulfonyl-2-(methylamino)phenyl]-3-phenylpropanoic acid |
| SMILES | CNc1c(C(CC(=O)O)c2ccccc2)cccc1S(=O)(=O)c1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C23H24N4O4S/c1-26-22-18(19(14-21(28)29)15-6-3-2-4-7-15)8-5-9-20(22)32(30,31)17-12-10-16(11-13-17)27-23(24)25/h2-13,19,26H,14H2,1H3,(H,28,29)(H4,24,25,27) |
| InChIKey | JICWBCVLCNEINQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|