C17H21NO9 — CID 67625262
(3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;2-(2-nitrophenyl)-2H-pyran (PubChem CID 67625262) has the molecular formula C17H21NO9 and a molecular weight of 383.35 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;2-(2-nitrophenyl)-2H-pyran.
| Compound Name | (3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;2-(2-nitrophenyl)-2H-pyran |
|---|---|
| PubChem CID | 67625262 |
| Molecular Formula | C17H21NO9 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (3R,4S,5R,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;2-(2-nitrophenyl)-2H-pyran |
| SMILES | O=[N+]([O-])c1ccccc1C1C=CC=CO1.OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H9NO3.C6H12O6/c13-12(14)10-6-2-1-5-9(10)11-7-3-4-8-15-11;7-1-2-3(8)4(9)5(10)6(11)12-2/h1-8,11H;2-11H,1H2/t;2-,3+,4+,5-,6?/m.1/s1 |
| InChIKey | SXKFJTWZBHSOLE-XSJVDAFBSA-N |
| XLogP | -0.49 |
| TPSA | 162.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|