C14H12N2O3 — CID 67725361
2-[2-oxo-1-[(Z)-prop-1-enyl]azetidin-3-yl]isoindole-1,3-dione (PubChem CID 67725361) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-[2-oxo-1-[(Z)-prop-1-enyl]azetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-oxo-1-[(Z)-prop-1-enyl]azetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67725361 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[2-oxo-1-[(Z)-prop-1-enyl]azetidin-3-yl]isoindole-1,3-dione |
| SMILES | C/C=C\N1CC(N2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C14H12N2O3/c1-2-7-15-8-11(14(15)19)16-12(17)9-5-3-4-6-10(9)13(16)18/h2-7,11H,8H2,1H3/b7-2- |
| InChIKey | GBCPRUODAWWBLU-UQCOIBPSSA-N |
| XLogP | 1.03 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|