C37H40N2O2 — CID 67726087
(2S)-1-amino-5-benzyl-2-(dibenzylamino)-7,7-dimethyl-1-phenyloct-4-ene-3,6-dione (PubChem CID 67726087) has the molecular formula C37H40N2O2 and a molecular weight of 544.74 g/mol. Its IUPAC name is (2S)-1-amino-5-benzyl-2-(dibenzylamino)-7,7-dimethyl-1-phenyloct-4-ene-3,6-dione.
| Compound Name | (2S)-1-amino-5-benzyl-2-(dibenzylamino)-7,7-dimethyl-1-phenyloct-4-ene-3,6-dione |
|---|---|
| PubChem CID | 67726087 |
| Molecular Formula | C37H40N2O2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | (2S)-1-amino-5-benzyl-2-(dibenzylamino)-7,7-dimethyl-1-phenyloct-4-ene-3,6-dione |
| SMILES | CC(C)(C)C(=O)C(=CC(=O)[C@H](C(N)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H40N2O2/c1-37(2,3)36(41)32(24-28-16-8-4-9-17-28)25-33(40)35(34(38)31-22-14-7-15-23-31)39(26-29-18-10-5-11-19-29)27-30-20-12-6-13-21-30/h4-23,25,34-35H,24,26-27,38H2,1-3H3/t34?,35-/m1/s1 |
| InChIKey | SEIJPKKYRMDMJA-ICBMVRCQSA-N |
| XLogP | 7.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|