C19H21ClN2O5S — CID 67732081
1-[2-(4-chlorophenyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethanone;methanamine;oxalic acid (PubChem CID 67732081) has the molecular formula C19H21ClN2O5S and a molecular weight of 424.91 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethanone;methanamine;oxalic acid.
| Compound Name | 1-[2-(4-chlorophenyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethanone;methanamine;oxalic acid |
|---|---|
| PubChem CID | 67732081 |
| Molecular Formula | C19H21ClN2O5S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2,3-dihydro-1,4-benzothiazin-4-yl]ethanone;methanamine;oxalic acid |
| SMILES | CC(=O)N1CC(c2ccc(Cl)cc2)Sc2ccccc21.CN.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H14ClNOS.C2H2O4.CH5N/c1-11(19)18-10-16(12-6-8-13(17)9-7-12)20-15-5-3-2-4-14(15)18;3-1(4)2(5)6;1-2/h2-9,16H,10H2,1H3;(H,3,4)(H,5,6);2H2,1H3 |
| InChIKey | ZMGLYCDHAKEKLK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|