C30H31NO4 — CID 67760078
1-[2-amino-3-[bis(4-methoxyphenyl)-phenylmethyl]phenyl]propane-1,3-diol (PubChem CID 67760078) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is 1-[2-amino-3-[bis(4-methoxyphenyl)-phenylmethyl]phenyl]propane-1,3-diol.
| Compound Name | 1-[2-amino-3-[bis(4-methoxyphenyl)-phenylmethyl]phenyl]propane-1,3-diol |
|---|---|
| PubChem CID | 67760078 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 1-[2-amino-3-[bis(4-methoxyphenyl)-phenylmethyl]phenyl]propane-1,3-diol |
| SMILES | COc1ccc(C(c2ccccc2)(c2ccc(OC)cc2)c2cccc(C(O)CCO)c2N)cc1 |
| InChI | InChI=1S/C30H31NO4/c1-34-24-15-11-22(12-16-24)30(21-7-4-3-5-8-21,23-13-17-25(35-2)18-14-23)27-10-6-9-26(29(27)31)28(33)19-20-32/h3-18,28,32-33H,19-20,31H2,1-2H3 |
| InChIKey | SNNZNIJTJXDNLR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|