C30H34O11 — CID 67784363
[3-[3-[[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]phenyl]phenyl] propanoate (PubChem CID 67784363) has the molecular formula C30H34O11 and a molecular weight of 570.59 g/mol. Its IUPAC name is [3-[3-[[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]phenyl]phenyl] propanoate.
| Compound Name | [3-[3-[[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]phenyl]phenyl] propanoate |
|---|---|
| PubChem CID | 67784363 |
| Molecular Formula | C30H34O11 |
| Molecular Weight | 570.59 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | [3-[3-[[(2S,3R,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]methyl]phenyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1cccc(-c2cccc(C[C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]3OC(C)=O)c2)c1 |
| InChI | InChI=1S/C30H34O11/c1-6-27(35)40-24-12-8-11-23(15-24)22-10-7-9-21(13-22)14-25-28(37-18(3)32)30(39-20(5)34)29(38-19(4)33)26(41-25)16-36-17(2)31/h7-13,15,25-26,28-30H,6,14,16H2,1-5H3/t25-,26+,28+,29+,30+/m0/s1 |
| InChIKey | MYTIZBMHGBCVNB-OTHMCYNBSA-N |
| XLogP | 3.34 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.59 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|